HOSTED BY WD6.NET
Software mirrors
Open-source repositories and downloads, served by our network.
Files & directories
![[ICO]](/icons/blank.gif){kind=icon} | Name | Last modified | Size | Description |
|---|---|---|---|---|
![[PARENTDIR]](/icons/back.gif){kind=icon} | Parent Directory | - | ||
![[ ]](/icons/unknown.gif){kind=icon} | CHECKSUMS | 2021-11-21 23:04 | 2.6K | |
![[TXT]](/icons/text.gif){kind=icon} | Catalyst-Plugin-PageCache-0.32.meta | 2016-08-18 09:55 | 777 | |
| Catalyst-Plugin-PageCache-0.32.readme | 2010-11-01 11:44 | 10K | |
![[ ]](/icons/compressed.gif){kind=icon} | Catalyst-Plugin-PageCache-0.32.tar.gz | 2016-08-18 10:03 | 43K | |
| Nginx-ParseLog-1.02.meta | 2016-07-28 10:57 | 850 | |
| Nginx-ParseLog-1.02.readme | 2016-07-28 06:20 | 594 | |
| Nginx-ParseLog-1.02.tar.gz | 2016-07-28 11:27 | 2.9K | |
| Nginx-ParseLog-1.03.meta | 2016-07-28 22:02 | 896 | |
| Nginx-ParseLog-1.03.readme | 2016-07-28 06:20 | 594 | |
| Nginx-ParseLog-1.03.tar.gz | 2016-07-28 22:06 | 3.0K |
No matching names in this directory.
Select a name to browse or download. Column headings sort the list.